C13H14F5N3S — CID 6905839
3-butyl-1-methyl-1-[(E)-(2,3,4,5,6-pentafluorophenyl)methylideneamino]thiourea (PubChem CID 6905839) has the molecular formula C13H14F5N3S and a molecular weight of 339.33 g/mol. Its IUPAC name is 3-butyl-1-methyl-1-[(E)-(2,3,4,5,6-pentafluorophenyl)methylideneamino]thiourea.
| Compound Name | 3-butyl-1-methyl-1-[(E)-(2,3,4,5,6-pentafluorophenyl)methylideneamino]thiourea |
|---|---|
| PubChem CID | 6905839 |
| Molecular Formula | C13H14F5N3S |
| Molecular Weight | 339.33 g/mol |
| Exact Mass | 339.08 |
| IUPAC Name | 3-butyl-1-methyl-1-[(E)-(2,3,4,5,6-pentafluorophenyl)methylideneamino]thiourea |
| SMILES | CCCCNC(=S)N(C)/N=C/c1c(F)c(F)c(F)c(F)c1F |
| InChI | InChI=1S/C13H14F5N3S/c1-3-4-5-19-13(22)21(2)20-6-7-8(14)10(16)12(18)11(17)9(7)15/h6H,3-5H2,1-2H3,(H,19,22)/b20-6+ |
| InChIKey | HCTYMYLIYVGJHL-CGOBSMCZSA-N |
| XLogP | 3.32 |
| TPSA | 27.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.33 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|