C18H27N3S — CID 3971286
3-butyl-1-methyl-1-[(4-phenylcyclohexylidene)amino]thiourea (PubChem CID 3971286) has the molecular formula C18H27N3S and a molecular weight of 317.50 g/mol. Its IUPAC name is 3-butyl-1-methyl-1-[(4-phenylcyclohexylidene)amino]thiourea.
| Compound Name | 3-butyl-1-methyl-1-[(4-phenylcyclohexylidene)amino]thiourea |
|---|---|
| PubChem CID | 3971286 |
| Molecular Formula | C18H27N3S |
| Molecular Weight | 317.50 g/mol |
| Exact Mass | 317.19 |
| IUPAC Name | 3-butyl-1-methyl-1-[(4-phenylcyclohexylidene)amino]thiourea |
| SMILES | CCCCNC(=S)N(C)N=C1CCC(c2ccccc2)CC1 |
| InChI | InChI=1S/C18H27N3S/c1-3-4-14-19-18(22)21(2)20-17-12-10-16(11-13-17)15-8-6-5-7-9-15/h5-9,16H,3-4,10-14H2,1-2H3,(H,19,22)/b20-17- |
| InChIKey | VJWFEOOKXOZNJN-JZJYNLBNSA-N |
| XLogP | 4.31 |
| TPSA | 27.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.50 |
| LogP ≤ 5 | 4.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|