C17H22ClN5S — CID 2438111
3-butyl-1-[(5-chloro-3-methyl-1-phenylpyrazol-4-yl)methylideneamino]-1-methylthiourea (PubChem CID 2438111) has the molecular formula C17H22ClN5S and a molecular weight of 363.92 g/mol. Its IUPAC name is 3-butyl-1-[(5-chloro-3-methyl-1-phenylpyrazol-4-yl)methylideneamino]-1-methylthiourea.
| Compound Name | 3-butyl-1-[(5-chloro-3-methyl-1-phenylpyrazol-4-yl)methylideneamino]-1-methylthiourea |
|---|---|
| PubChem CID | 2438111 |
| Molecular Formula | C17H22ClN5S |
| Molecular Weight | 363.92 g/mol |
| Exact Mass | 363.13 |
| IUPAC Name | 3-butyl-1-[(5-chloro-3-methyl-1-phenylpyrazol-4-yl)methylideneamino]-1-methylthiourea |
| SMILES | CCCCNC(=S)N(C)N=Cc1c(C)nn(-c2ccccc2)c1Cl |
| InChI | InChI=1S/C17H22ClN5S/c1-4-5-11-19-17(24)22(3)20-12-15-13(2)21-23(16(15)18)14-9-7-6-8-10-14/h6-10,12H,4-5,11H2,1-3H3,(H,19,24) |
| InChIKey | JVXDYQOCWYEOMK-UHFFFAOYSA-N |
| XLogP | 3.77 |
| TPSA | 45.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.92 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|