C22H23ClN2O3 — CID 69059401
3-[6-(4-butoxyphenyl)-4-oxo-1H-pyridin-3-yl]-5-chloro-2,6-dimethyl-1H-pyridin-4-one (PubChem CID 69059401) has the molecular formula C22H23ClN2O3 and a molecular weight of 398.89 g/mol. Its IUPAC name is 3-[6-(4-butoxyphenyl)-4-oxo-1H-pyridin-3-yl]-5-chloro-2,6-dimethyl-1H-pyridin-4-one.
| Compound Name | 3-[6-(4-butoxyphenyl)-4-oxo-1H-pyridin-3-yl]-5-chloro-2,6-dimethyl-1H-pyridin-4-one |
|---|---|
| PubChem CID | 69059401 |
| Molecular Formula | C22H23ClN2O3 |
| Molecular Weight | 398.89 g/mol |
| Exact Mass | 398.14 |
| IUPAC Name | 3-[6-(4-butoxyphenyl)-4-oxo-1H-pyridin-3-yl]-5-chloro-2,6-dimethyl-1H-pyridin-4-one |
| SMILES | CCCCOc1ccc(-c2cc(=O)c(-c3c(C)[nH]c(C)c(Cl)c3=O)c[nH]2)cc1 |
| InChI | InChI=1S/C22H23ClN2O3/c1-4-5-10-28-16-8-6-15(7-9-16)18-11-19(26)17(12-24-18)20-13(2)25-14(3)21(23)22(20)27/h6-9,11-12H,4-5,10H2,1-3H3,(H,24,26)(H,25,27) |
| InChIKey | HHUURYYOQYVFCY-UHFFFAOYSA-N |
| XLogP | 4.85 |
| TPSA | 74.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.89 |
| LogP ≤ 5 | 4.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|