C30H28F2N4O — CID 69064146
3-[1-[bis(4-fluorophenyl)methyl]-3-cyano-4,6-dimethylpyrrolo[2,3-b]pyridin-2-yl]-N-tert-butylprop-2-enamide (PubChem CID 69064146) has the molecular formula C30H28F2N4O and a molecular weight of 498.58 g/mol. Its IUPAC name is 3-[1-[bis(4-fluorophenyl)methyl]-3-cyano-4,6-dimethylpyrrolo[2,3-b]pyridin-2-yl]-N-tert-butylprop-2-enamide.
| Compound Name | 3-[1-[bis(4-fluorophenyl)methyl]-3-cyano-4,6-dimethylpyrrolo[2,3-b]pyridin-2-yl]-N-tert-butylprop-2-enamide |
|---|---|
| PubChem CID | 69064146 |
| Molecular Formula | C30H28F2N4O |
| Molecular Weight | 498.58 g/mol |
| Exact Mass | 498.22 |
| IUPAC Name | 3-[1-[bis(4-fluorophenyl)methyl]-3-cyano-4,6-dimethylpyrrolo[2,3-b]pyridin-2-yl]-N-tert-butylprop-2-enamide |
| SMILES | Cc1cc(C)c2c(C#N)c(C=CC(=O)NC(C)(C)C)n(C(c3ccc(F)cc3)c3ccc(F)cc3)c2n1 |
| InChI | InChI=1S/C30H28F2N4O/c1-18-16-19(2)34-29-27(18)24(17-33)25(14-15-26(37)35-30(3,4)5)36(29)28(20-6-10-22(31)11-7-20)21-8-12-23(32)13-9-21/h6-16,28H,1-5H3,(H,35,37) |
| InChIKey | VVVXVHVHPGPZGG-UHFFFAOYSA-N |
| XLogP | 6.37 |
| TPSA | 70.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 498.58 |
| LogP ≤ 5 | 6.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|