C26H26FN3O3 — CID 69075186
(4R,9aS)-4-(4-fluorophenyl)-1-[3-methoxy-4-(4-methylimidazol-1-yl)phenyl]-3-methylidene-1,4,7,8,9,9a-hexahydropyrido[2,1-c][1,4]oxazin-6-one (PubChem CID 69075186) has the molecular formula C26H26FN3O3 and a molecular weight of 447.51 g/mol. Its IUPAC name is (4R,9aS)-4-(4-fluorophenyl)-1-[3-methoxy-4-(4-methylimidazol-1-yl)phenyl]-3-methylidene-1,4,7,8,9,9a-hexahydropyrido[2,1-c][1,4]oxazin-6-one.
| Compound Name | (4R,9aS)-4-(4-fluorophenyl)-1-[3-methoxy-4-(4-methylimidazol-1-yl)phenyl]-3-methylidene-1,4,7,8,9,9a-hexahydropyrido[2,1-c][1,4]oxazin-6-one |
|---|---|
| PubChem CID | 69075186 |
| Molecular Formula | C26H26FN3O3 |
| Molecular Weight | 447.51 g/mol |
| Exact Mass | 447.20 |
| IUPAC Name | (4R,9aS)-4-(4-fluorophenyl)-1-[3-methoxy-4-(4-methylimidazol-1-yl)phenyl]-3-methylidene-1,4,7,8,9,9a-hexahydropyrido[2,1-c][1,4]oxazin-6-one |
| SMILES | C=C1OC(c2ccc(-n3cnc(C)c3)c(OC)c2)[C@@H]2CCCC(=O)N2[C@@H]1c1ccc(F)cc1 |
| InChI | InChI=1S/C26H26FN3O3/c1-16-14-29(15-28-16)21-12-9-19(13-23(21)32-3)26-22-5-4-6-24(31)30(22)25(17(2)33-26)18-7-10-20(27)11-8-18/h7-15,22,25-26H,2,4-6H2,1,3H3/t22-,25-,26?/m0/s1 |
| InChIKey | HXUMYZZBXOWUPN-UQVBRKOYSA-N |
| XLogP | 5.04 |
| TPSA | 56.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.51 |
| LogP ≤ 5 | 5.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |