C21H16ClN5OS — CID 69079049
2-[2-(1,3-benzothiazol-2-yl)ethyl]-1-(4-chlorophenyl)-9-methylpurin-6-one (PubChem CID 69079049) has the molecular formula C21H16ClN5OS and a molecular weight of 421.91 g/mol. Its IUPAC name is 2-[2-(1,3-benzothiazol-2-yl)ethyl]-1-(4-chlorophenyl)-9-methylpurin-6-one.
| Compound Name | 2-[2-(1,3-benzothiazol-2-yl)ethyl]-1-(4-chlorophenyl)-9-methylpurin-6-one |
|---|---|
| PubChem CID | 69079049 |
| Molecular Formula | C21H16ClN5OS |
| Molecular Weight | 421.91 g/mol |
| Exact Mass | 421.08 |
| IUPAC Name | 2-[2-(1,3-benzothiazol-2-yl)ethyl]-1-(4-chlorophenyl)-9-methylpurin-6-one |
| SMILES | Cn1cnc2c(=O)n(-c3ccc(Cl)cc3)c(CCc3nc4ccccc4s3)nc21 |
| InChI | InChI=1S/C21H16ClN5OS/c1-26-12-23-19-20(26)25-17(27(21(19)28)14-8-6-13(22)7-9-14)10-11-18-24-15-4-2-3-5-16(15)29-18/h2-9,12H,10-11H2,1H3 |
| InChIKey | KBRCBSQTVWNULR-UHFFFAOYSA-N |
| XLogP | 4.17 |
| TPSA | 65.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.91 |
| LogP ≤ 5 | 4.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |