C13H14F3NO6 — CID 69081364
(4-acetylphenyl) (2R)-2-amino-3-hydroxypropanoate;2,2,2-trifluoroacetic acid (PubChem CID 69081364) has the molecular formula C13H14F3NO6 and a molecular weight of 337.25 g/mol. Its IUPAC name is (4-acetylphenyl) (2R)-2-amino-3-hydroxypropanoate;2,2,2-trifluoroacetic acid.
| Compound Name | (4-acetylphenyl) (2R)-2-amino-3-hydroxypropanoate;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 69081364 |
| Molecular Formula | C13H14F3NO6 |
| Molecular Weight | 337.25 g/mol |
| Exact Mass | 337.08 |
| IUPAC Name | (4-acetylphenyl) (2R)-2-amino-3-hydroxypropanoate;2,2,2-trifluoroacetic acid |
| SMILES | CC(=O)c1ccc(OC(=O)[C@H](N)CO)cc1.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C11H13NO4.C2HF3O2/c1-7(14)8-2-4-9(5-3-8)16-11(15)10(12)6-13;3-2(4,5)1(6)7/h2-5,10,13H,6,12H2,1H3;(H,6,7)/t10-;/m1./s1 |
| InChIKey | MWDMNRWATXKOQH-HNCPQSOCSA-N |
| XLogP | 0.75 |
| TPSA | 126.92 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.25 |
| LogP ≤ 5 | 0.75 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|