C18H21N3O2 — CID 69093181
4-[1-(6,7-dimethoxynaphthalen-2-yl)-2-methylpropyl]-2H-triazole (PubChem CID 69093181) has the molecular formula C18H21N3O2 and a molecular weight of 311.39 g/mol. Its IUPAC name is 4-[1-(6,7-dimethoxynaphthalen-2-yl)-2-methylpropyl]-2H-triazole.
| Compound Name | 4-[1-(6,7-dimethoxynaphthalen-2-yl)-2-methylpropyl]-2H-triazole |
|---|---|
| PubChem CID | 69093181 |
| Molecular Formula | C18H21N3O2 |
| Molecular Weight | 311.39 g/mol |
| Exact Mass | 311.16 |
| IUPAC Name | 4-[1-(6,7-dimethoxynaphthalen-2-yl)-2-methylpropyl]-2H-triazole |
| SMILES | COc1cc2ccc(C(c3cn[nH]n3)C(C)C)cc2cc1OC |
| InChI | InChI=1S/C18H21N3O2/c1-11(2)18(15-10-19-21-20-15)13-6-5-12-8-16(22-3)17(23-4)9-14(12)7-13/h5-11,18H,1-4H3,(H,19,20,21) |
| InChIKey | XZNMUMHNPGVTCT-UHFFFAOYSA-N |
| XLogP | 3.76 |
| TPSA | 60.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.39 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |