C11H16N4 — CID 69096109
4-methyl-6-pentyl-1H-pyrazolo[3,4-d]pyrimidine (PubChem CID 69096109) has the molecular formula C11H16N4 and a molecular weight of 204.28 g/mol. Its IUPAC name is 4-methyl-6-pentyl-1H-pyrazolo[3,4-d]pyrimidine.
| Compound Name | 4-methyl-6-pentyl-1H-pyrazolo[3,4-d]pyrimidine |
|---|---|
| PubChem CID | 69096109 |
| Molecular Formula | C11H16N4 |
| Molecular Weight | 204.28 g/mol |
| Exact Mass | 204.14 |
| IUPAC Name | 4-methyl-6-pentyl-1H-pyrazolo[3,4-d]pyrimidine |
| SMILES | CCCCCc1nc(C)c2cn[nH]c2n1 |
| InChI | InChI=1S/C11H16N4/c1-3-4-5-6-10-13-8(2)9-7-12-15-11(9)14-10/h7H,3-6H2,1-2H3,(H,12,13,14,15) |
| InChIKey | GSCILAHMQHFVSZ-UHFFFAOYSA-N |
| XLogP | 2.39 |
| TPSA | 54.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 204.28 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|