About 4-methyl-6-pentyl-1H-pyrazolo[3,4-d]pyrimidine
4-methyl-6-pentyl-1H-pyrazolo[3,4-d]pyrimidine (PubChem CID 69096109) has the molecular formula C11H16N4
and a molecular weight of 204.28 g/mol. Its IUPAC name is 4-methyl-6-pentyl-1H-pyrazolo[3,4-d]pyrimidine.
Molecular Properties
| Compound Name | 4-methyl-6-pentyl-1H-pyrazolo[3,4-d]pyrimidine |
| PubChem CID | 69096109 |
| Molecular Formula | C11H16N4 |
| Molecular Weight | 204.28 g/mol |
| Exact Mass | 204.14 |
| IUPAC Name | 4-methyl-6-pentyl-1H-pyrazolo[3,4-d]pyrimidine |
| SMILES | CCCCCc1nc(C)c2cn[nH]c2n1 |
| InChI | InChI=1S/C11H16N4/c1-3-4-5-6-10-13-8(2)9-7-12-15-11(9)14-10/h7H,3-6H2,1-2H3,(H,12,13,14,15) |
| InChIKey | GSCILAHMQHFVSZ-UHFFFAOYSA-N |
| XLogP | 2.39 |
| TPSA | 54.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 204.28 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 4-methyl-6-pentyl-1H-pyrazolo[3,4-d]pyrimidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-methyl-6-pentyl-1H-pyrazolo[3,4-d]pyrimidine?
The IUPAC name of 4-methyl-6-pentyl-1H-pyrazolo[3,4-d]pyrimidine (CID 69096109) is 4-methyl-6-pentyl-1H-pyrazolo[3,4-d]pyrimidine.
What is the SMILES notation for 4-methyl-6-pentyl-1H-pyrazolo[3,4-d]pyrimidine?
The canonical SMILES for 4-methyl-6-pentyl-1H-pyrazolo[3,4-d]pyrimidine is CCCCCc1nc(C)c2cn[nH]c2n1.
What is the InChIKey of 4-methyl-6-pentyl-1H-pyrazolo[3,4-d]pyrimidine?
The InChIKey is GSCILAHMQHFVSZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H16N4/c1-3-4-5-6-10-13-8(2)9-7-12-15-11(9)14-10/h7H,3-6H2,1-2H3,(H,12,13,14,15).
What are the key properties of 4-methyl-6-pentyl-1H-pyrazolo[3,4-d]pyrimidine?
4-methyl-6-pentyl-1H-pyrazolo[3,4-d]pyrimidine has a molecular weight of 204.28 g/mol, XLogP of 2.39, 4 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-methyl-6-pentyl-1H-pyrazolo[3,4-d]pyrimidine is sourced from PubChem (CID 69096109), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).