C21H27N2O5PS — CID 69099617
[2-[2-[ethyl(naphthalen-2-yl)carbamoyl]piperidin-1-yl]-2-oxoethyl]sulfanylmethylphosphonic acid (PubChem CID 69099617) has the molecular formula C21H27N2O5PS and a molecular weight of 450.50 g/mol. Its IUPAC name is [2-[2-[ethyl(naphthalen-2-yl)carbamoyl]piperidin-1-yl]-2-oxoethyl]sulfanylmethylphosphonic acid.
| Compound Name | [2-[2-[ethyl(naphthalen-2-yl)carbamoyl]piperidin-1-yl]-2-oxoethyl]sulfanylmethylphosphonic acid |
|---|---|
| PubChem CID | 69099617 |
| Molecular Formula | C21H27N2O5PS |
| Molecular Weight | 450.50 g/mol |
| Exact Mass | 450.14 |
| IUPAC Name | [2-[2-[ethyl(naphthalen-2-yl)carbamoyl]piperidin-1-yl]-2-oxoethyl]sulfanylmethylphosphonic acid |
| SMILES | CCN(C(=O)C1CCCCN1C(=O)CSCP(=O)(O)O)c1ccc2ccccc2c1 |
| InChI | InChI=1S/C21H27N2O5PS/c1-2-22(18-11-10-16-7-3-4-8-17(16)13-18)21(25)19-9-5-6-12-23(19)20(24)14-30-15-29(26,27)28/h3-4,7-8,10-11,13,19H,2,5-6,9,12,14-15H2,1H3,(H2,26,27,28) |
| InChIKey | DCMXVORPAWRGHI-UHFFFAOYSA-N |
| XLogP | 3.44 |
| TPSA | 98.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.50 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|