C20H30N4O5S — CID 69104445
tert-butyl 2-[[4-(N,N-dimethyl-N'-methylsulfonylcarbamimidoyl)phenyl]carbamoyl]pyrrolidine-1-carboxylate (PubChem CID 69104445) has the molecular formula C20H30N4O5S and a molecular weight of 438.55 g/mol. Its IUPAC name is tert-butyl 2-[[4-(N,N-dimethyl-N'-methylsulfonylcarbamimidoyl)phenyl]carbamoyl]pyrrolidine-1-carboxylate.
| Compound Name | tert-butyl 2-[[4-(N,N-dimethyl-N'-methylsulfonylcarbamimidoyl)phenyl]carbamoyl]pyrrolidine-1-carboxylate |
|---|---|
| PubChem CID | 69104445 |
| Molecular Formula | C20H30N4O5S |
| Molecular Weight | 438.55 g/mol |
| Exact Mass | 438.19 |
| IUPAC Name | tert-butyl 2-[[4-(N,N-dimethyl-N'-methylsulfonylcarbamimidoyl)phenyl]carbamoyl]pyrrolidine-1-carboxylate |
| SMILES | CN(C)C(=NS(C)(=O)=O)c1ccc(NC(=O)C2CCCN2C(=O)OC(C)(C)C)cc1 |
| InChI | InChI=1S/C20H30N4O5S/c1-20(2,3)29-19(26)24-13-7-8-16(24)18(25)21-15-11-9-14(10-12-15)17(23(4)5)22-30(6,27)28/h9-12,16H,7-8,13H2,1-6H3,(H,21,25) |
| InChIKey | YLPFIMISAUTFJK-UHFFFAOYSA-N |
| XLogP | 2.29 |
| TPSA | 108.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.55 |
| LogP ≤ 5 | 2.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|