C13H13F3N2O4 — CID 69105824
(2S)-4-[(2,3,5-trifluorophenyl)methyl]piperazine-1,2-dicarboxylic acid (PubChem CID 69105824) has the molecular formula C13H13F3N2O4 and a molecular weight of 318.25 g/mol. Its IUPAC name is (2S)-4-[(2,3,5-trifluorophenyl)methyl]piperazine-1,2-dicarboxylic acid.
| Compound Name | (2S)-4-[(2,3,5-trifluorophenyl)methyl]piperazine-1,2-dicarboxylic acid |
|---|---|
| PubChem CID | 69105824 |
| Molecular Formula | C13H13F3N2O4 |
| Molecular Weight | 318.25 g/mol |
| Exact Mass | 318.08 |
| IUPAC Name | (2S)-4-[(2,3,5-trifluorophenyl)methyl]piperazine-1,2-dicarboxylic acid |
| SMILES | O=C(O)[C@@H]1CN(Cc2cc(F)cc(F)c2F)CCN1C(=O)O |
| InChI | InChI=1S/C13H13F3N2O4/c14-8-3-7(11(16)9(15)4-8)5-17-1-2-18(13(21)22)10(6-17)12(19)20/h3-4,10H,1-2,5-6H2,(H,19,20)(H,21,22)/t10-/m0/s1 |
| InChIKey | LYHQDYGJIYKKPV-JTQLQIEISA-N |
| XLogP | 1.35 |
| TPSA | 81.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.25 |
| LogP ≤ 5 | 1.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|