C32H35N5O4 — CID 69109751
9H-fluoren-9-ylmethyl N-[(2S)-6-[(2-aminoacetyl)amino]-1-[(2-methyl-1H-indol-5-yl)amino]-1-oxohexan-2-yl]carbamate (PubChem CID 69109751) has the molecular formula C32H35N5O4 and a molecular weight of 553.66 g/mol. Its IUPAC name is 9H-fluoren-9-ylmethyl N-[(2S)-6-[(2-aminoacetyl)amino]-1-[(2-methyl-1H-indol-5-yl)amino]-1-oxohexan-2-yl]carbamate.
| Compound Name | 9H-fluoren-9-ylmethyl N-[(2S)-6-[(2-aminoacetyl)amino]-1-[(2-methyl-1H-indol-5-yl)amino]-1-oxohexan-2-yl]carbamate |
|---|---|
| PubChem CID | 69109751 |
| Molecular Formula | C32H35N5O4 |
| Molecular Weight | 553.66 g/mol |
| Exact Mass | 553.27 |
| IUPAC Name | 9H-fluoren-9-ylmethyl N-[(2S)-6-[(2-aminoacetyl)amino]-1-[(2-methyl-1H-indol-5-yl)amino]-1-oxohexan-2-yl]carbamate |
| SMILES | Cc1cc2cc(NC(=O)[C@H](CCCCNC(=O)CN)NC(=O)OCC3c4ccccc4-c4ccccc43)ccc2[nH]1 |
| InChI | InChI=1S/C32H35N5O4/c1-20-16-21-17-22(13-14-28(21)35-20)36-31(39)29(12-6-7-15-34-30(38)18-33)37-32(40)41-19-27-25-10-4-2-8-23(25)24-9-3-5-11-26(24)27/h2-5,8-11,13-14,16-17,27,29,35H,6-7,12,15,18-19,33H2,1H3,(H,34,38)(H,36,39)(H,37,40)/t29-/m0/s1 |
| InChIKey | BKWDEYGSYSXNGW-LJAQVGFWSA-N |
| XLogP | 4.57 |
| TPSA | 138.34 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 553.66 |
| LogP ≤ 5 | 4.57 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|