About [2-[[3-chloro-5-(trifluoromethyl)-2-pyridinyl]oxy]-6-(2-hydroxyethoxy)phenyl] prop-2-enoate;hydrate
[2-[[3-chloro-5-(trifluoromethyl)-2-pyridinyl]oxy]-6-(2-hydroxyethoxy)phenyl] prop-2-enoate;hydrate (PubChem CID 69110478) has the molecular formula C17H15ClF3NO6
and a molecular weight of 421.76 g/mol. Its IUPAC name is [2-[[3-chloro-5-(trifluoromethyl)-2-pyridinyl]oxy]-6-(2-hydroxyethoxy)phenyl] prop-2-enoate;hydrate.
Molecular Properties
| Compound Name | [2-[[3-chloro-5-(trifluoromethyl)-2-pyridinyl]oxy]-6-(2-hydroxyethoxy)phenyl] prop-2-enoate;hydrate |
| PubChem CID | 69110478 |
| Molecular Formula | C17H15ClF3NO6 |
| Molecular Weight | 421.76 g/mol |
| Exact Mass | 421.05 |
| IUPAC Name | [2-[[3-chloro-5-(trifluoromethyl)-2-pyridinyl]oxy]-6-(2-hydroxyethoxy)phenyl] prop-2-enoate;hydrate |
| SMILES | C=CC(=O)Oc1c(OCCO)cccc1Oc1ncc(C(F)(F)F)cc1Cl.O |
| InChI | InChI=1S/C17H13ClF3NO5.H2O/c1-2-14(24)27-15-12(25-7-6-23)4-3-5-13(15)26-16-11(18)8-10(9-22-16)17(19,20)21;/h2-5,8-9,23H,1,6-7H2;1H2 |
| InChIKey | VVEPIZWCGZAGLW-UHFFFAOYSA-N |
| XLogP | 3.18 |
| TPSA | 109.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 421.76 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|
Analyze [2-[[3-chloro-5-(trifluoromethyl)-2-pyridinyl]oxy]-6-(2-hydroxyethoxy)phenyl] prop-2-enoate;hydrate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [2-[[3-chloro-5-(trifluoromethyl)-2-pyridinyl]oxy]-6-(2-hydroxyethoxy)phenyl] prop-2-enoate;hydrate?
The IUPAC name of [2-[[3-chloro-5-(trifluoromethyl)-2-pyridinyl]oxy]-6-(2-hydroxyethoxy)phenyl] prop-2-enoate;hydrate (CID 69110478) is [2-[[3-chloro-5-(trifluoromethyl)-2-pyridinyl]oxy]-6-(2-hydroxyethoxy)phenyl] prop-2-enoate;hydrate.
What is the SMILES notation for [2-[[3-chloro-5-(trifluoromethyl)-2-pyridinyl]oxy]-6-(2-hydroxyethoxy)phenyl] prop-2-enoate;hydrate?
The canonical SMILES for [2-[[3-chloro-5-(trifluoromethyl)-2-pyridinyl]oxy]-6-(2-hydroxyethoxy)phenyl] prop-2-enoate;hydrate is C=CC(=O)Oc1c(OCCO)cccc1Oc1ncc(C(F)(F)F)cc1Cl.O.
What is the InChIKey of [2-[[3-chloro-5-(trifluoromethyl)-2-pyridinyl]oxy]-6-(2-hydroxyethoxy)phenyl] prop-2-enoate;hydrate?
The InChIKey is VVEPIZWCGZAGLW-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H13ClF3NO5.H2O/c1-2-14(24)27-15-12(25-7-6-23)4-3-5-13(15)26-16-11(18)8-10(9-22-16)17(19,20)21;/h2-5,8-9,23H,1,6-7H2;1H2.
What are the key properties of [2-[[3-chloro-5-(trifluoromethyl)-2-pyridinyl]oxy]-6-(2-hydroxyethoxy)phenyl] prop-2-enoate;hydrate?
[2-[[3-chloro-5-(trifluoromethyl)-2-pyridinyl]oxy]-6-(2-hydroxyethoxy)phenyl] prop-2-enoate;hydrate has a molecular weight of 421.76 g/mol, XLogP of 3.18, 7 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for [2-[[3-chloro-5-(trifluoromethyl)-2-pyridinyl]oxy]-6-(2-hydroxyethoxy)phenyl] prop-2-enoate;hydrate is sourced from PubChem (CID 69110478), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).