About N'-methylsulfonyl-N'-[(5-propan-2-ylthiophen-2-yl)methyl]oxamide
N'-methylsulfonyl-N'-[(5-propan-2-ylthiophen-2-yl)methyl]oxamide (PubChem CID 69116655) has the molecular formula C11H16N2O4S2
and a molecular weight of 304.39 g/mol. Its IUPAC name is N'-methylsulfonyl-N'-[(5-propan-2-ylthiophen-2-yl)methyl]oxamide.
Molecular Properties
| Compound Name | N'-methylsulfonyl-N'-[(5-propan-2-ylthiophen-2-yl)methyl]oxamide |
| PubChem CID | 69116655 |
| Molecular Formula | C11H16N2O4S2 |
| Molecular Weight | 304.39 g/mol |
| Exact Mass | 304.06 |
| IUPAC Name | N'-methylsulfonyl-N'-[(5-propan-2-ylthiophen-2-yl)methyl]oxamide |
| SMILES | CC(C)c1ccc(CN(C(=O)C(N)=O)S(C)(=O)=O)s1 |
| InChI | InChI=1S/C11H16N2O4S2/c1-7(2)9-5-4-8(18-9)6-13(19(3,16)17)11(15)10(12)14/h4-5,7H,6H2,1-3H3,(H2,12,14) |
| InChIKey | MYNBTJYZNLRZEP-UHFFFAOYSA-N |
| XLogP | 0.64 |
| TPSA | 97.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 304.39 |
| LogP ≤ 5 | 0.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|
Analyze N'-methylsulfonyl-N'-[(5-propan-2-ylthiophen-2-yl)methyl]oxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N'-methylsulfonyl-N'-[(5-propan-2-ylthiophen-2-yl)methyl]oxamide?
The IUPAC name of N'-methylsulfonyl-N'-[(5-propan-2-ylthiophen-2-yl)methyl]oxamide (CID 69116655) is N'-methylsulfonyl-N'-[(5-propan-2-ylthiophen-2-yl)methyl]oxamide.
What is the SMILES notation for N'-methylsulfonyl-N'-[(5-propan-2-ylthiophen-2-yl)methyl]oxamide?
The canonical SMILES for N'-methylsulfonyl-N'-[(5-propan-2-ylthiophen-2-yl)methyl]oxamide is CC(C)c1ccc(CN(C(=O)C(N)=O)S(C)(=O)=O)s1.
What is the InChIKey of N'-methylsulfonyl-N'-[(5-propan-2-ylthiophen-2-yl)methyl]oxamide?
The InChIKey is MYNBTJYZNLRZEP-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H16N2O4S2/c1-7(2)9-5-4-8(18-9)6-13(19(3,16)17)11(15)10(12)14/h4-5,7H,6H2,1-3H3,(H2,12,14).
What are the key properties of N'-methylsulfonyl-N'-[(5-propan-2-ylthiophen-2-yl)methyl]oxamide?
N'-methylsulfonyl-N'-[(5-propan-2-ylthiophen-2-yl)methyl]oxamide has a molecular weight of 304.39 g/mol, XLogP of 0.64, 4 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for N'-methylsulfonyl-N'-[(5-propan-2-ylthiophen-2-yl)methyl]oxamide is sourced from PubChem (CID 69116655), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).