C11H16N2O4S2 — CID 69116655
N'-methylsulfonyl-N'-[(5-propan-2-ylthiophen-2-yl)methyl]oxamide (PubChem CID 69116655) has the molecular formula C11H16N2O4S2 and a molecular weight of 304.39 g/mol. Its IUPAC name is N'-methylsulfonyl-N'-[(5-propan-2-ylthiophen-2-yl)methyl]oxamide.
| Compound Name | N'-methylsulfonyl-N'-[(5-propan-2-ylthiophen-2-yl)methyl]oxamide |
|---|---|
| PubChem CID | 69116655 |
| Molecular Formula | C11H16N2O4S2 |
| Molecular Weight | 304.39 g/mol |
| Exact Mass | 304.06 |
| IUPAC Name | N'-methylsulfonyl-N'-[(5-propan-2-ylthiophen-2-yl)methyl]oxamide |
| SMILES | CC(C)c1ccc(CN(C(=O)C(N)=O)S(C)(=O)=O)s1 |
| InChI | InChI=1S/C11H16N2O4S2/c1-7(2)9-5-4-8(18-9)6-13(19(3,16)17)11(15)10(12)14/h4-5,7H,6H2,1-3H3,(H2,12,14) |
| InChIKey | MYNBTJYZNLRZEP-UHFFFAOYSA-N |
| XLogP | 0.64 |
| TPSA | 97.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.39 |
| LogP ≤ 5 | 0.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|