About azepan-2-one;(2S)-pyrrolidine-2-carboxylic acid
azepan-2-one;(2S)-pyrrolidine-2-carboxylic acid (PubChem CID 69116899) has the molecular formula C11H20N2O3
and a molecular weight of 228.29 g/mol. Its IUPAC name is azepan-2-one;(2S)-pyrrolidine-2-carboxylic acid.
Molecular Properties
| Compound Name | azepan-2-one;(2S)-pyrrolidine-2-carboxylic acid |
| PubChem CID | 69116899 |
| Molecular Formula | C11H20N2O3 |
| Molecular Weight | 228.29 g/mol |
| Exact Mass | 228.15 |
| IUPAC Name | azepan-2-one;(2S)-pyrrolidine-2-carboxylic acid |
| SMILES | O=C(O)[C@@H]1CCCN1.O=C1CCCCCN1 |
| InChI | InChI=1S/C6H11NO.C5H9NO2/c8-6-4-2-1-3-5-7-6;7-5(8)4-2-1-3-6-4/h1-5H2,(H,7,8);4,6H,1-3H2,(H,7,8)/t;4-/m.0/s1 |
| InChIKey | SWYYTLLNQZSRIF-VWMHFEHESA-N |
| XLogP | 0.50 |
| TPSA | 78.43 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 228.29 |
| LogP ≤ 5 | 0.50 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze azepan-2-one;(2S)-pyrrolidine-2-carboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of azepan-2-one;(2S)-pyrrolidine-2-carboxylic acid?
The IUPAC name of azepan-2-one;(2S)-pyrrolidine-2-carboxylic acid (CID 69116899) is azepan-2-one;(2S)-pyrrolidine-2-carboxylic acid.
What is the SMILES notation for azepan-2-one;(2S)-pyrrolidine-2-carboxylic acid?
The canonical SMILES for azepan-2-one;(2S)-pyrrolidine-2-carboxylic acid is O=C(O)[C@@H]1CCCN1.O=C1CCCCCN1.
What is the InChIKey of azepan-2-one;(2S)-pyrrolidine-2-carboxylic acid?
The InChIKey is SWYYTLLNQZSRIF-VWMHFEHESA-N. The full InChI is InChI=1S/C6H11NO.C5H9NO2/c8-6-4-2-1-3-5-7-6;7-5(8)4-2-1-3-6-4/h1-5H2,(H,7,8);4,6H,1-3H2,(H,7,8)/t;4-/m.0/s1.
What are the key properties of azepan-2-one;(2S)-pyrrolidine-2-carboxylic acid?
azepan-2-one;(2S)-pyrrolidine-2-carboxylic acid has a molecular weight of 228.29 g/mol, XLogP of 0.50, 1 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for azepan-2-one;(2S)-pyrrolidine-2-carboxylic acid is sourced from PubChem (CID 69116899), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).