C37H46N4O7S2 — CID 69117115
4-[[(2R)-2-[[2-[[(7S)-3,3-dibutyl-7-methylsulfanyl-4,6-dioxo-5-phenyl-2,7-dihydro-1,2,5-benzothiadiazepin-8-yl]oxy]acetyl]amino]-2-phenylacetyl]amino]butanoic acid (PubChem CID 69117115) has the molecular formula C37H46N4O7S2 and a molecular weight of 722.93 g/mol. Its IUPAC name is 4-[[(2R)-2-[[2-[[(7S)-3,3-dibutyl-7-methylsulfanyl-4,6-dioxo-5-phenyl-2,7-dihydro-1,2,5-benzothiadiazepin-8-yl]oxy]acetyl]amino]-2-phenylacetyl]amino]butanoic acid.
| Compound Name | 4-[[(2R)-2-[[2-[[(7S)-3,3-dibutyl-7-methylsulfanyl-4,6-dioxo-5-phenyl-2,7-dihydro-1,2,5-benzothiadiazepin-8-yl]oxy]acetyl]amino]-2-phenylacetyl]amino]butanoic acid |
|---|---|
| PubChem CID | 69117115 |
| Molecular Formula | C37H46N4O7S2 |
| Molecular Weight | 722.93 g/mol |
| Exact Mass | 722.28 |
| IUPAC Name | 4-[[(2R)-2-[[2-[[(7S)-3,3-dibutyl-7-methylsulfanyl-4,6-dioxo-5-phenyl-2,7-dihydro-1,2,5-benzothiadiazepin-8-yl]oxy]acetyl]amino]-2-phenylacetyl]amino]butanoic acid |
| SMILES | CCCCC1(CCCC)NSC2=C(C(=O)[C@@H](SC)C(OCC(=O)N[C@@H](C(=O)NCCCC(=O)O)c3ccccc3)=C2)N(c2ccccc2)C1=O |
| InChI | InChI=1S/C37H46N4O7S2/c1-4-6-20-37(21-7-5-2)36(47)41(26-17-12-9-13-18-26)32-28(50-40-37)23-27(34(49-3)33(32)45)48-24-29(42)39-31(25-15-10-8-11-16-25)35(46)38-22-14-19-30(43)44/h8-13,15-18,23,31,34,40H,4-7,14,19-22,24H2,1-3H3,(H,38,46)(H,39,42)(H,43,44)/t31-,34+/m1/s1 |
| InChIKey | QTGCLBSLADHISW-FJQKOURKSA-N |
| XLogP | 5.66 |
| TPSA | 154.14 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 722.93 |
| LogP ≤ 5 | 5.66 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|