C24H15ClF3N3O4 — CID 69137969
3-[(3E)-3-[[amino-(4-chlorobenzoyl)amino]methylidene]-2-oxo-6-(trifluoromethyl)indol-1-yl]benzoic acid (PubChem CID 69137969) has the molecular formula C24H15ClF3N3O4 and a molecular weight of 501.85 g/mol. Its IUPAC name is 3-[(3E)-3-[[amino-(4-chlorobenzoyl)amino]methylidene]-2-oxo-6-(trifluoromethyl)indol-1-yl]benzoic acid.
| Compound Name | 3-[(3E)-3-[[amino-(4-chlorobenzoyl)amino]methylidene]-2-oxo-6-(trifluoromethyl)indol-1-yl]benzoic acid |
|---|---|
| PubChem CID | 69137969 |
| Molecular Formula | C24H15ClF3N3O4 |
| Molecular Weight | 501.85 g/mol |
| Exact Mass | 501.07 |
| IUPAC Name | 3-[(3E)-3-[[amino-(4-chlorobenzoyl)amino]methylidene]-2-oxo-6-(trifluoromethyl)indol-1-yl]benzoic acid |
| SMILES | NN(/C=C1/C(=O)N(c2cccc(C(=O)O)c2)c2cc(C(F)(F)F)ccc21)C(=O)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C24H15ClF3N3O4/c25-16-7-4-13(5-8-16)21(32)30(29)12-19-18-9-6-15(24(26,27)28)11-20(18)31(22(19)33)17-3-1-2-14(10-17)23(34)35/h1-12H,29H2,(H,34,35)/b19-12+ |
| InChIKey | FLULUUSOKVZTNI-XDHOZWIPSA-N |
| XLogP | 5.09 |
| TPSA | 103.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 501.85 |
| LogP ≤ 5 | 5.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|