C26H27N3O7 — CID 69152966
ethyl [1-[6-[4-(4-methoxyphenyl)phenoxy]-3-nitro-2-pyridinyl]piperidin-4-yl] carbonate (PubChem CID 69152966) has the molecular formula C26H27N3O7 and a molecular weight of 493.52 g/mol. Its IUPAC name is ethyl [1-[6-[4-(4-methoxyphenyl)phenoxy]-3-nitro-2-pyridinyl]piperidin-4-yl] carbonate.
| Compound Name | ethyl [1-[6-[4-(4-methoxyphenyl)phenoxy]-3-nitro-2-pyridinyl]piperidin-4-yl] carbonate |
|---|---|
| PubChem CID | 69152966 |
| Molecular Formula | C26H27N3O7 |
| Molecular Weight | 493.52 g/mol |
| Exact Mass | 493.18 |
| IUPAC Name | ethyl [1-[6-[4-(4-methoxyphenyl)phenoxy]-3-nitro-2-pyridinyl]piperidin-4-yl] carbonate |
| SMILES | CCOC(=O)OC1CCN(c2nc(Oc3ccc(-c4ccc(OC)cc4)cc3)ccc2[N+](=O)[O-])CC1 |
| InChI | InChI=1S/C26H27N3O7/c1-3-34-26(30)36-22-14-16-28(17-15-22)25-23(29(31)32)12-13-24(27-25)35-21-10-6-19(7-11-21)18-4-8-20(33-2)9-5-18/h4-13,22H,3,14-17H2,1-2H3 |
| InChIKey | IEMSTXWLVGGWIC-UHFFFAOYSA-N |
| XLogP | 5.60 |
| TPSA | 113.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 493.52 |
| LogP ≤ 5 | 5.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|