C16H11F4NO4S — CID 69164826
6-fluoro-9,9-dimethyl-3-nitro-2-(trifluoromethyl)thioxanthene 10,10-dioxide (PubChem CID 69164826) has the molecular formula C16H11F4NO4S and a molecular weight of 389.33 g/mol. Its IUPAC name is 6-fluoro-9,9-dimethyl-3-nitro-2-(trifluoromethyl)thioxanthene 10,10-dioxide.
| Compound Name | 6-fluoro-9,9-dimethyl-3-nitro-2-(trifluoromethyl)thioxanthene 10,10-dioxide |
|---|---|
| PubChem CID | 69164826 |
| Molecular Formula | C16H11F4NO4S |
| Molecular Weight | 389.33 g/mol |
| Exact Mass | 389.03 |
| IUPAC Name | 6-fluoro-9,9-dimethyl-3-nitro-2-(trifluoromethyl)thioxanthene 10,10-dioxide |
| SMILES | CC1(C)c2ccc(F)cc2S(=O)(=O)c2cc([N+](=O)[O-])c(C(F)(F)F)cc21 |
| InChI | InChI=1S/C16H11F4NO4S/c1-15(2)9-4-3-8(17)5-13(9)26(24,25)14-7-12(21(22)23)10(6-11(14)15)16(18,19)20/h3-7H,1-2H3 |
| InChIKey | OVLXWZUVOZBQHQ-UHFFFAOYSA-N |
| XLogP | 4.22 |
| TPSA | 77.28 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.33 |
| LogP ≤ 5 | 4.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|