C27H45NO5Si — CID 6917334
tert-butyl N-[(4S,5S)-2,2-dimethyl-4-[(E)-2-methyl-3-[(2S,6R)-4-methylidene-6-(3-trimethylsilylprop-2-ynyl)oxan-2-yl]prop-2-enyl]-1,3-dioxan-5-yl]carbamate (PubChem CID 6917334) has the molecular formula C27H45NO5Si and a molecular weight of 491.75 g/mol. Its IUPAC name is tert-butyl N-[(4S,5S)-2,2-dimethyl-4-[(E)-2-methyl-3-[(2S,6R)-4-methylidene-6-(3-trimethylsilylprop-2-ynyl)oxan-2-yl]prop-2-enyl]-1,3-dioxan-5-yl]carbamate.
| Compound Name | tert-butyl N-[(4S,5S)-2,2-dimethyl-4-[(E)-2-methyl-3-[(2S,6R)-4-methylidene-6-(3-trimethylsilylprop-2-ynyl)oxan-2-yl]prop-2-enyl]-1,3-dioxan-5-yl]carbamate |
|---|---|
| PubChem CID | 6917334 |
| Molecular Formula | C27H45NO5Si |
| Molecular Weight | 491.75 g/mol |
| Exact Mass | 491.31 |
| IUPAC Name | tert-butyl N-[(4S,5S)-2,2-dimethyl-4-[(E)-2-methyl-3-[(2S,6R)-4-methylidene-6-(3-trimethylsilylprop-2-ynyl)oxan-2-yl]prop-2-enyl]-1,3-dioxan-5-yl]carbamate |
| SMILES | C=C1C[C@H](CC#C[Si](C)(C)C)O[C@H](/C=C(\C)C[C@@H]2OC(C)(C)OC[C@@H]2NC(=O)OC(C)(C)C)C1 |
| InChI | InChI=1S/C27H45NO5Si/c1-19-14-21(12-11-13-34(8,9)10)31-22(15-19)16-20(2)17-24-23(18-30-27(6,7)32-24)28-25(29)33-26(3,4)5/h16,21-24H,1,12,14-15,17-18H2,2-10H3,(H,28,29)/b20-16+/t21-,22-,23-,24-/m0/s1 |
| InChIKey | QFPRHCCYYWTTRV-SKPRFARXSA-N |
| XLogP | 5.74 |
| TPSA | 66.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 491.75 |
| LogP ≤ 5 | 5.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|