C16H29NO5 — CID 6917376
tert-butyl N-[(4S,5S)-4-[(E)-4-hydroxy-2-methylbut-2-enyl]-2,2-dimethyl-1,3-dioxan-5-yl]carbamate (PubChem CID 6917376) has the molecular formula C16H29NO5 and a molecular weight of 315.41 g/mol. Its IUPAC name is tert-butyl N-[(4S,5S)-4-[(E)-4-hydroxy-2-methylbut-2-enyl]-2,2-dimethyl-1,3-dioxan-5-yl]carbamate.
| Compound Name | tert-butyl N-[(4S,5S)-4-[(E)-4-hydroxy-2-methylbut-2-enyl]-2,2-dimethyl-1,3-dioxan-5-yl]carbamate |
|---|---|
| PubChem CID | 6917376 |
| Molecular Formula | C16H29NO5 |
| Molecular Weight | 315.41 g/mol |
| Exact Mass | 315.20 |
| IUPAC Name | tert-butyl N-[(4S,5S)-4-[(E)-4-hydroxy-2-methylbut-2-enyl]-2,2-dimethyl-1,3-dioxan-5-yl]carbamate |
| SMILES | C/C(=C\CO)C[C@@H]1OC(C)(C)OC[C@@H]1NC(=O)OC(C)(C)C |
| InChI | InChI=1S/C16H29NO5/c1-11(7-8-18)9-13-12(10-20-16(5,6)21-13)17-14(19)22-15(2,3)4/h7,12-13,18H,8-10H2,1-6H3,(H,17,19)/b11-7+/t12-,13-/m0/s1 |
| InChIKey | UGSASYVMRSCCKR-XBJLJFKASA-N |
| XLogP | 2.36 |
| TPSA | 77.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.41 |
| LogP ≤ 5 | 2.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|