C28H30N2O4S2 — CID 69175515
[2-[3-(4-cyanophenoxy)propyl-methylamino]-7-bicyclo[2.2.1]heptanyl] 2-hydroxy-2,2-dithiophen-2-ylacetate (PubChem CID 69175515) has the molecular formula C28H30N2O4S2 and a molecular weight of 522.69 g/mol. Its IUPAC name is [2-[3-(4-cyanophenoxy)propyl-methylamino]-7-bicyclo[2.2.1]heptanyl] 2-hydroxy-2,2-dithiophen-2-ylacetate.
| Compound Name | [2-[3-(4-cyanophenoxy)propyl-methylamino]-7-bicyclo[2.2.1]heptanyl] 2-hydroxy-2,2-dithiophen-2-ylacetate |
|---|---|
| PubChem CID | 69175515 |
| Molecular Formula | C28H30N2O4S2 |
| Molecular Weight | 522.69 g/mol |
| Exact Mass | 522.16 |
| IUPAC Name | [2-[3-(4-cyanophenoxy)propyl-methylamino]-7-bicyclo[2.2.1]heptanyl] 2-hydroxy-2,2-dithiophen-2-ylacetate |
| SMILES | CN(CCCOc1ccc(C#N)cc1)C1CC2CCC1C2OC(=O)C(O)(c1cccs1)c1cccs1 |
| InChI | InChI=1S/C28H30N2O4S2/c1-30(13-4-14-33-21-10-7-19(18-29)8-11-21)23-17-20-9-12-22(23)26(20)34-27(31)28(32,24-5-2-15-35-24)25-6-3-16-36-25/h2-3,5-8,10-11,15-16,20,22-23,26,32H,4,9,12-14,17H2,1H3 |
| InChIKey | AQNZOOCMYLMLPQ-UHFFFAOYSA-N |
| XLogP | 5.03 |
| TPSA | 82.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 522.69 |
| LogP ≤ 5 | 5.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|