C18H16ClN5O2 — CID 69190327
8-(2-chloroethoxy)-2-imidazol-1-yl-9-methoxybenzo[f][2,7]naphthyridin-4-amine (PubChem CID 69190327) has the molecular formula C18H16ClN5O2 and a molecular weight of 369.81 g/mol. Its IUPAC name is 8-(2-chloroethoxy)-2-imidazol-1-yl-9-methoxybenzo[f][2,7]naphthyridin-4-amine.
| Compound Name | 8-(2-chloroethoxy)-2-imidazol-1-yl-9-methoxybenzo[f][2,7]naphthyridin-4-amine |
|---|---|
| PubChem CID | 69190327 |
| Molecular Formula | C18H16ClN5O2 |
| Molecular Weight | 369.81 g/mol |
| Exact Mass | 369.10 |
| IUPAC Name | 8-(2-chloroethoxy)-2-imidazol-1-yl-9-methoxybenzo[f][2,7]naphthyridin-4-amine |
| SMILES | COc1cc2c(cc1OCCCl)ncc1c(N)nc(-n3ccnc3)cc12 |
| InChI | InChI=1S/C18H16ClN5O2/c1-25-15-6-12-11-7-17(24-4-3-21-10-24)23-18(20)13(11)9-22-14(12)8-16(15)26-5-2-19/h3-4,6-10H,2,5H2,1H3,(H2,20,23) |
| InChIKey | PSUJNQDAWGXAPN-UHFFFAOYSA-N |
| XLogP | 3.18 |
| TPSA | 88.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.81 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|