C27H24ClN3O5 — CID 69210060
2-chloro-N-[3-[2-(7-methoxy-3,3-dimethyl-2,4-dihydroisoquinolin-1-ylidene)acetyl]phenyl]-4-nitrobenzamide (PubChem CID 69210060) has the molecular formula C27H24ClN3O5 and a molecular weight of 505.96 g/mol. Its IUPAC name is 2-chloro-N-[3-[2-(7-methoxy-3,3-dimethyl-2,4-dihydroisoquinolin-1-ylidene)acetyl]phenyl]-4-nitrobenzamide.
| Compound Name | 2-chloro-N-[3-[2-(7-methoxy-3,3-dimethyl-2,4-dihydroisoquinolin-1-ylidene)acetyl]phenyl]-4-nitrobenzamide |
|---|---|
| PubChem CID | 69210060 |
| Molecular Formula | C27H24ClN3O5 |
| Molecular Weight | 505.96 g/mol |
| Exact Mass | 505.14 |
| IUPAC Name | 2-chloro-N-[3-[2-(7-methoxy-3,3-dimethyl-2,4-dihydroisoquinolin-1-ylidene)acetyl]phenyl]-4-nitrobenzamide |
| SMILES | COc1ccc2c(c1)C(=CC(=O)c1cccc(NC(=O)c3ccc([N+](=O)[O-])cc3Cl)c1)NC(C)(C)C2 |
| InChI | InChI=1S/C27H24ClN3O5/c1-27(2)15-17-7-9-20(36-3)13-22(17)24(30-27)14-25(32)16-5-4-6-18(11-16)29-26(33)21-10-8-19(31(34)35)12-23(21)28/h4-14,30H,15H2,1-3H3,(H,29,33) |
| InChIKey | JOIPIGLGUAOKFV-UHFFFAOYSA-N |
| XLogP | 5.66 |
| TPSA | 110.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 505.96 |
| LogP ≤ 5 | 5.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|