C27H25N3O5 — CID 69213399
N-[3-[2-(7-methoxy-3,3-dimethyl-2,4-dihydroisoquinolin-1-ylidene)acetyl]phenyl]-2-nitrobenzamide (PubChem CID 69213399) has the molecular formula C27H25N3O5 and a molecular weight of 471.51 g/mol. Its IUPAC name is N-[3-[2-(7-methoxy-3,3-dimethyl-2,4-dihydroisoquinolin-1-ylidene)acetyl]phenyl]-2-nitrobenzamide.
| Compound Name | N-[3-[2-(7-methoxy-3,3-dimethyl-2,4-dihydroisoquinolin-1-ylidene)acetyl]phenyl]-2-nitrobenzamide |
|---|---|
| PubChem CID | 69213399 |
| Molecular Formula | C27H25N3O5 |
| Molecular Weight | 471.51 g/mol |
| Exact Mass | 471.18 |
| IUPAC Name | N-[3-[2-(7-methoxy-3,3-dimethyl-2,4-dihydroisoquinolin-1-ylidene)acetyl]phenyl]-2-nitrobenzamide |
| SMILES | COc1ccc2c(c1)C(=CC(=O)c1cccc(NC(=O)c3ccccc3[N+](=O)[O-])c1)NC(C)(C)C2 |
| InChI | InChI=1S/C27H25N3O5/c1-27(2)16-18-11-12-20(35-3)14-22(18)23(29-27)15-25(31)17-7-6-8-19(13-17)28-26(32)21-9-4-5-10-24(21)30(33)34/h4-15,29H,16H2,1-3H3,(H,28,32) |
| InChIKey | MRMLGVDUMDIFKR-UHFFFAOYSA-N |
| XLogP | 5.00 |
| TPSA | 110.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 471.51 |
| LogP ≤ 5 | 5.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|