C23H26N2O2 — CID 69215477
(2Z)-2-(6-methoxy-3,3-dimethyl-2H-isoindol-1-ylidene)-1-(4-pyrrolidin-1-ylphenyl)ethanone (PubChem CID 69215477) has the molecular formula C23H26N2O2 and a molecular weight of 362.47 g/mol. Its IUPAC name is (2Z)-2-(6-methoxy-3,3-dimethyl-2H-isoindol-1-ylidene)-1-(4-pyrrolidin-1-ylphenyl)ethanone.
| Compound Name | (2Z)-2-(6-methoxy-3,3-dimethyl-2H-isoindol-1-ylidene)-1-(4-pyrrolidin-1-ylphenyl)ethanone |
|---|---|
| PubChem CID | 69215477 |
| Molecular Formula | C23H26N2O2 |
| Molecular Weight | 362.47 g/mol |
| Exact Mass | 362.20 |
| IUPAC Name | (2Z)-2-(6-methoxy-3,3-dimethyl-2H-isoindol-1-ylidene)-1-(4-pyrrolidin-1-ylphenyl)ethanone |
| SMILES | COc1ccc2c(c1)/C(=C/C(=O)c1ccc(N3CCCC3)cc1)NC2(C)C |
| InChI | InChI=1S/C23H26N2O2/c1-23(2)20-11-10-18(27-3)14-19(20)21(24-23)15-22(26)16-6-8-17(9-7-16)25-12-4-5-13-25/h6-11,14-15,24H,4-5,12-13H2,1-3H3/b21-15- |
| InChIKey | ABWCBYKUZGGEOT-QNGOZBTKSA-N |
| XLogP | 4.36 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.47 |
| LogP ≤ 5 | 4.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|