C20H18N2O2S — CID 69212049
4-[(2Z)-2-(6-methoxy-2,2-dimethyl-3H-1,3-benzothiazin-4-ylidene)acetyl]benzonitrile (PubChem CID 69212049) has the molecular formula C20H18N2O2S and a molecular weight of 350.44 g/mol. Its IUPAC name is 4-[(2Z)-2-(6-methoxy-2,2-dimethyl-3H-1,3-benzothiazin-4-ylidene)acetyl]benzonitrile.
| Compound Name | 4-[(2Z)-2-(6-methoxy-2,2-dimethyl-3H-1,3-benzothiazin-4-ylidene)acetyl]benzonitrile |
|---|---|
| PubChem CID | 69212049 |
| Molecular Formula | C20H18N2O2S |
| Molecular Weight | 350.44 g/mol |
| Exact Mass | 350.11 |
| IUPAC Name | 4-[(2Z)-2-(6-methoxy-2,2-dimethyl-3H-1,3-benzothiazin-4-ylidene)acetyl]benzonitrile |
| SMILES | COc1ccc2c(c1)/C(=C/C(=O)c1ccc(C#N)cc1)NC(C)(C)S2 |
| InChI | InChI=1S/C20H18N2O2S/c1-20(2)22-17(16-10-15(24-3)8-9-19(16)25-20)11-18(23)14-6-4-13(12-21)5-7-14/h4-11,22H,1-3H3/b17-11- |
| InChIKey | ANMDVTKEBHZXKJ-BOPFTXTBSA-N |
| XLogP | 4.22 |
| TPSA | 62.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.44 |
| LogP ≤ 5 | 4.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|