C22H24N2O4 — CID 69210024
2-(3,3-diethyl-7-methoxy-2,4-dihydroisoquinolin-1-ylidene)-1-(4-nitrophenyl)ethanone (PubChem CID 69210024) has the molecular formula C22H24N2O4 and a molecular weight of 380.44 g/mol. Its IUPAC name is 2-(3,3-diethyl-7-methoxy-2,4-dihydroisoquinolin-1-ylidene)-1-(4-nitrophenyl)ethanone.
| Compound Name | 2-(3,3-diethyl-7-methoxy-2,4-dihydroisoquinolin-1-ylidene)-1-(4-nitrophenyl)ethanone |
|---|---|
| PubChem CID | 69210024 |
| Molecular Formula | C22H24N2O4 |
| Molecular Weight | 380.44 g/mol |
| Exact Mass | 380.17 |
| IUPAC Name | 2-(3,3-diethyl-7-methoxy-2,4-dihydroisoquinolin-1-ylidene)-1-(4-nitrophenyl)ethanone |
| SMILES | CCC1(CC)Cc2ccc(OC)cc2C(=CC(=O)c2ccc([N+](=O)[O-])cc2)N1 |
| InChI | InChI=1S/C22H24N2O4/c1-4-22(5-2)14-16-8-11-18(28-3)12-19(16)20(23-22)13-21(25)15-6-9-17(10-7-15)24(26)27/h6-13,23H,4-5,14H2,1-3H3 |
| InChIKey | URQMMQVAUOBSNY-UHFFFAOYSA-N |
| XLogP | 4.53 |
| TPSA | 81.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.44 |
| LogP ≤ 5 | 4.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|