C28H35N3O10S — CID 69223207
[(3aR,4S,6aS)-2,3,3a,4,5,6a-hexahydrofuro[2,3-b]furan-4-yl] N-[(2S,3R)-4-cyclopentyloxy-3-hydroxy-4-[(3-nitrophenyl)sulfonylamino]-1-phenylbutan-2-yl]carbamate (PubChem CID 69223207) has the molecular formula C28H35N3O10S and a molecular weight of 605.67 g/mol. Its IUPAC name is [(3aR,4S,6aS)-2,3,3a,4,5,6a-hexahydrofuro[2,3-b]furan-4-yl] N-[(2S,3R)-4-cyclopentyloxy-3-hydroxy-4-[(3-nitrophenyl)sulfonylamino]-1-phenylbutan-2-yl]carbamate.
| Compound Name | [(3aR,4S,6aS)-2,3,3a,4,5,6a-hexahydrofuro[2,3-b]furan-4-yl] N-[(2S,3R)-4-cyclopentyloxy-3-hydroxy-4-[(3-nitrophenyl)sulfonylamino]-1-phenylbutan-2-yl]carbamate |
|---|---|
| PubChem CID | 69223207 |
| Molecular Formula | C28H35N3O10S |
| Molecular Weight | 605.67 g/mol |
| Exact Mass | 605.20 |
| IUPAC Name | [(3aR,4S,6aS)-2,3,3a,4,5,6a-hexahydrofuro[2,3-b]furan-4-yl] N-[(2S,3R)-4-cyclopentyloxy-3-hydroxy-4-[(3-nitrophenyl)sulfonylamino]-1-phenylbutan-2-yl]carbamate |
| SMILES | O=C(N[C@@H](Cc1ccccc1)[C@@H](O)C(NS(=O)(=O)c1cccc([N+](=O)[O-])c1)OC1CCCC1)O[C@@H]1CO[C@@H]2OCC[C@@H]21 |
| InChI | InChI=1S/C28H35N3O10S/c32-25(26(40-20-10-4-5-11-20)30-42(36,37)21-12-6-9-19(16-21)31(34)35)23(15-18-7-2-1-3-8-18)29-28(33)41-24-17-39-27-22(24)13-14-38-27/h1-3,6-9,12,16,20,22-27,30,32H,4-5,10-11,13-15,17H2,(H,29,33)/t22-,23+,24-,25-,26?,27+/m1/s1 |
| InChIKey | PCEMYELUUONQPO-RWCFRXEZSA-N |
| XLogP | 2.62 |
| TPSA | 175.56 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 605.67 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|