C22H28N2O7S — CID 154310813
[(2S,3R)-4-cyclopentyloxy-3-hydroxy-4-[(3-hydroxyphenyl)sulfonylamino]-1-phenylbutan-2-yl]carbamic acid (PubChem CID 154310813) has the molecular formula C22H28N2O7S and a molecular weight of 464.54 g/mol. Its IUPAC name is [(2S,3R)-4-cyclopentyloxy-3-hydroxy-4-[(3-hydroxyphenyl)sulfonylamino]-1-phenylbutan-2-yl]carbamic acid.
| Compound Name | [(2S,3R)-4-cyclopentyloxy-3-hydroxy-4-[(3-hydroxyphenyl)sulfonylamino]-1-phenylbutan-2-yl]carbamic acid |
|---|---|
| PubChem CID | 154310813 |
| Molecular Formula | C22H28N2O7S |
| Molecular Weight | 464.54 g/mol |
| Exact Mass | 464.16 |
| IUPAC Name | [(2S,3R)-4-cyclopentyloxy-3-hydroxy-4-[(3-hydroxyphenyl)sulfonylamino]-1-phenylbutan-2-yl]carbamic acid |
| SMILES | O=C(O)N[C@@H](Cc1ccccc1)[C@@H](O)C(NS(=O)(=O)c1cccc(O)c1)OC1CCCC1 |
| InChI | InChI=1S/C22H28N2O7S/c25-16-9-6-12-18(14-16)32(29,30)24-21(31-17-10-4-5-11-17)20(26)19(23-22(27)28)13-15-7-2-1-3-8-15/h1-3,6-9,12,14,17,19-21,23-26H,4-5,10-11,13H2,(H,27,28)/t19-,20+,21?/m0/s1 |
| InChIKey | HNUNOBUSSRDTRZ-MCOCGALXSA-N |
| XLogP | 2.20 |
| TPSA | 145.19 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.54 |
| LogP ≤ 5 | 2.20 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|