C36H44N2O9S — CID 87919341
[(2S,3R)-4-[(3aS,4R,6aR)-2,3,3a,4,5,6a-hexahydrofuro[2,3-b]furan-4-yl]-4-[cyclohexyloxy-(3-phenylmethoxyphenyl)sulfonylamino]-3-hydroxy-1-phenylbutan-2-yl]carbamic acid (PubChem CID 87919341) has the molecular formula C36H44N2O9S and a molecular weight of 680.82 g/mol. Its IUPAC name is [(2S,3R)-4-[(3aS,4R,6aR)-2,3,3a,4,5,6a-hexahydrofuro[2,3-b]furan-4-yl]-4-[cyclohexyloxy-(3-phenylmethoxyphenyl)sulfonylamino]-3-hydroxy-1-phenylbutan-2-yl]carbamic acid.
| Compound Name | [(2S,3R)-4-[(3aS,4R,6aR)-2,3,3a,4,5,6a-hexahydrofuro[2,3-b]furan-4-yl]-4-[cyclohexyloxy-(3-phenylmethoxyphenyl)sulfonylamino]-3-hydroxy-1-phenylbutan-2-yl]carbamic acid |
|---|---|
| PubChem CID | 87919341 |
| Molecular Formula | C36H44N2O9S |
| Molecular Weight | 680.82 g/mol |
| Exact Mass | 680.28 |
| IUPAC Name | [(2S,3R)-4-[(3aS,4R,6aR)-2,3,3a,4,5,6a-hexahydrofuro[2,3-b]furan-4-yl]-4-[cyclohexyloxy-(3-phenylmethoxyphenyl)sulfonylamino]-3-hydroxy-1-phenylbutan-2-yl]carbamic acid |
| SMILES | O=C(O)N[C@@H](Cc1ccccc1)[C@@H](O)C([C@@H]1CO[C@H]2OCC[C@H]21)N(OC1CCCCC1)S(=O)(=O)c1cccc(OCc2ccccc2)c1 |
| InChI | InChI=1S/C36H44N2O9S/c39-34(32(37-36(40)41)21-25-11-4-1-5-12-25)33(31-24-46-35-30(31)19-20-44-35)38(47-27-15-8-3-9-16-27)48(42,43)29-18-10-17-28(22-29)45-23-26-13-6-2-7-14-26/h1-2,4-7,10-14,17-18,22,27,30-35,37,39H,3,8-9,15-16,19-21,23-24H2,(H,40,41)/t30-,31+,32-,33?,34+,35+/m0/s1 |
| InChIKey | RJHCMWCWPNOXCY-DRPOSTMGSA-N |
| XLogP | 5.14 |
| TPSA | 143.86 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 680.82 |
| LogP ≤ 5 | 5.14 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|