C27H26N4O6 — CID 69228699
[2-[benzyl-[[2-(9H-fluoren-9-ylmethoxycarbonylamino)acetyl]amino]amino]-2-oxoethyl]carbamic acid (PubChem CID 69228699) has the molecular formula C27H26N4O6 and a molecular weight of 502.53 g/mol. Its IUPAC name is [2-[benzyl-[[2-(9H-fluoren-9-ylmethoxycarbonylamino)acetyl]amino]amino]-2-oxoethyl]carbamic acid.
| Compound Name | [2-[benzyl-[[2-(9H-fluoren-9-ylmethoxycarbonylamino)acetyl]amino]amino]-2-oxoethyl]carbamic acid |
|---|---|
| PubChem CID | 69228699 |
| Molecular Formula | C27H26N4O6 |
| Molecular Weight | 502.53 g/mol |
| Exact Mass | 502.19 |
| IUPAC Name | [2-[benzyl-[[2-(9H-fluoren-9-ylmethoxycarbonylamino)acetyl]amino]amino]-2-oxoethyl]carbamic acid |
| SMILES | O=C(O)NCC(=O)N(Cc1ccccc1)NC(=O)CNC(=O)OCC1c2ccccc2-c2ccccc21 |
| InChI | InChI=1S/C27H26N4O6/c32-24(30-31(25(33)15-28-26(34)35)16-18-8-2-1-3-9-18)14-29-27(36)37-17-23-21-12-6-4-10-19(21)20-11-5-7-13-22(20)23/h1-13,23,28H,14-17H2,(H,29,36)(H,30,32)(H,34,35) |
| InChIKey | FEWWFJCAKYSBRG-UHFFFAOYSA-N |
| XLogP | 2.85 |
| TPSA | 137.07 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 502.53 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|