C23H31NO5 — CID 69229930
tert-butyl 6-[[(E)-2-hydroxy-2-phenylhex-4-enoyl]oxymethyl]-3-azabicyclo[3.1.0]hexane-3-carboxylate (PubChem CID 69229930) has the molecular formula C23H31NO5 and a molecular weight of 401.50 g/mol. Its IUPAC name is tert-butyl 6-[[(E)-2-hydroxy-2-phenylhex-4-enoyl]oxymethyl]-3-azabicyclo[3.1.0]hexane-3-carboxylate.
| Compound Name | tert-butyl 6-[[(E)-2-hydroxy-2-phenylhex-4-enoyl]oxymethyl]-3-azabicyclo[3.1.0]hexane-3-carboxylate |
|---|---|
| PubChem CID | 69229930 |
| Molecular Formula | C23H31NO5 |
| Molecular Weight | 401.50 g/mol |
| Exact Mass | 401.22 |
| IUPAC Name | tert-butyl 6-[[(E)-2-hydroxy-2-phenylhex-4-enoyl]oxymethyl]-3-azabicyclo[3.1.0]hexane-3-carboxylate |
| SMILES | C/C=C/CC(O)(C(=O)OCC1C2CN(C(=O)OC(C)(C)C)CC12)c1ccccc1 |
| InChI | InChI=1S/C23H31NO5/c1-5-6-12-23(27,16-10-8-7-9-11-16)20(25)28-15-19-17-13-24(14-18(17)19)21(26)29-22(2,3)4/h5-11,17-19,27H,12-15H2,1-4H3/b6-5+ |
| InChIKey | KNWAPYPIHCWVQS-AATRIKPKSA-N |
| XLogP | 3.50 |
| TPSA | 76.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.50 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|