C18H19F3N2O2 — CID 69234632
methyl (2S)-2-[[2-amino-5-[4-(trifluoromethyl)phenyl]phenyl]methylamino]propanoate (PubChem CID 69234632) has the molecular formula C18H19F3N2O2 and a molecular weight of 352.36 g/mol. Its IUPAC name is methyl (2S)-2-[[2-amino-5-[4-(trifluoromethyl)phenyl]phenyl]methylamino]propanoate.
| Compound Name | methyl (2S)-2-[[2-amino-5-[4-(trifluoromethyl)phenyl]phenyl]methylamino]propanoate |
|---|---|
| PubChem CID | 69234632 |
| Molecular Formula | C18H19F3N2O2 |
| Molecular Weight | 352.36 g/mol |
| Exact Mass | 352.14 |
| IUPAC Name | methyl (2S)-2-[[2-amino-5-[4-(trifluoromethyl)phenyl]phenyl]methylamino]propanoate |
| SMILES | COC(=O)[C@H](C)NCc1cc(-c2ccc(C(F)(F)F)cc2)ccc1N |
| InChI | InChI=1S/C18H19F3N2O2/c1-11(17(24)25-2)23-10-14-9-13(5-8-16(14)22)12-3-6-15(7-4-12)18(19,20)21/h3-9,11,23H,10,22H2,1-2H3/t11-/m0/s1 |
| InChIKey | QZJQDWWKGHNDFJ-NSHDSACASA-N |
| XLogP | 3.61 |
| TPSA | 64.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.36 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|