About trans-(1S,2S)-1-methyl-2-(1,3-thiazole-2-carbonyl)cyclopentane-1-carboxylic acid
trans-(1S,2S)-1-methyl-2-(1,3-thiazole-2-carbonyl)cyclopentane-1-carboxylic acid (PubChem CID 69242625) has the molecular formula C11H13NO3S
and a molecular weight of 239.30 g/mol. Its IUPAC name is trans-(1S,2S)-1-methyl-2-(1,3-thiazole-2-carbonyl)cyclopentane-1-carboxylic acid.
Molecular Properties
| Compound Name | trans-(1S,2S)-1-methyl-2-(1,3-thiazole-2-carbonyl)cyclopentane-1-carboxylic acid |
| PubChem CID | 69242625 |
| Molecular Formula | C11H13NO3S |
| Molecular Weight | 239.30 g/mol |
| Exact Mass | 239.06 |
| IUPAC Name | trans-(1S,2S)-1-methyl-2-(1,3-thiazole-2-carbonyl)cyclopentane-1-carboxylic acid |
| SMILES | C[C@]1(C(=O)O)CCC[C@@H]1C(=O)c1nccs1 |
| InChI | InChI=1S/C11H13NO3S/c1-11(10(14)15)4-2-3-7(11)8(13)9-12-5-6-16-9/h5-7H,2-4H2,1H3,(H,14,15)/t7-,11+/m1/s1 |
| InChIKey | SXIPLYARADEEKI-HQJQHLMTSA-N |
| XLogP | 2.22 |
| TPSA | 67.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 239.30 |
| LogP ≤ 5 | 2.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze trans-(1S,2S)-1-methyl-2-(1,3-thiazole-2-carbonyl)cyclopentane-1-carboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of trans-(1S,2S)-1-methyl-2-(1,3-thiazole-2-carbonyl)cyclopentane-1-carboxylic acid?
The IUPAC name of trans-(1S,2S)-1-methyl-2-(1,3-thiazole-2-carbonyl)cyclopentane-1-carboxylic acid (CID 69242625) is trans-(1S,2S)-1-methyl-2-(1,3-thiazole-2-carbonyl)cyclopentane-1-carboxylic acid.
What is the SMILES notation for trans-(1S,2S)-1-methyl-2-(1,3-thiazole-2-carbonyl)cyclopentane-1-carboxylic acid?
The canonical SMILES for trans-(1S,2S)-1-methyl-2-(1,3-thiazole-2-carbonyl)cyclopentane-1-carboxylic acid is C[C@]1(C(=O)O)CCC[C@@H]1C(=O)c1nccs1.
What is the InChIKey of trans-(1S,2S)-1-methyl-2-(1,3-thiazole-2-carbonyl)cyclopentane-1-carboxylic acid?
The InChIKey is SXIPLYARADEEKI-HQJQHLMTSA-N. The full InChI is InChI=1S/C11H13NO3S/c1-11(10(14)15)4-2-3-7(11)8(13)9-12-5-6-16-9/h5-7H,2-4H2,1H3,(H,14,15)/t7-,11+/m1/s1.
What are the key properties of trans-(1S,2S)-1-methyl-2-(1,3-thiazole-2-carbonyl)cyclopentane-1-carboxylic acid?
trans-(1S,2S)-1-methyl-2-(1,3-thiazole-2-carbonyl)cyclopentane-1-carboxylic acid has a molecular weight of 239.30 g/mol, XLogP of 2.22, 3 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for trans-(1S,2S)-1-methyl-2-(1,3-thiazole-2-carbonyl)cyclopentane-1-carboxylic acid is sourced from PubChem (CID 69242625), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).