C22H25N5O2 — CID 69244369
(9R,10R)-10-[[(2R)-4-(benzimidazol-1-yl)butan-2-yl]amino]-9-hydroxy-1,3-diazatricyclo[6.4.1.04,13]trideca-4,6,8(13)-trien-2-one (PubChem CID 69244369) has the molecular formula C22H25N5O2 and a molecular weight of 391.48 g/mol. Its IUPAC name is (9R,10R)-10-[[(2R)-4-(benzimidazol-1-yl)butan-2-yl]amino]-9-hydroxy-1,3-diazatricyclo[6.4.1.04,13]trideca-4,6,8(13)-trien-2-one.
| Compound Name | (9R,10R)-10-[[(2R)-4-(benzimidazol-1-yl)butan-2-yl]amino]-9-hydroxy-1,3-diazatricyclo[6.4.1.04,13]trideca-4,6,8(13)-trien-2-one |
|---|---|
| PubChem CID | 69244369 |
| Molecular Formula | C22H25N5O2 |
| Molecular Weight | 391.48 g/mol |
| Exact Mass | 391.20 |
| IUPAC Name | (9R,10R)-10-[[(2R)-4-(benzimidazol-1-yl)butan-2-yl]amino]-9-hydroxy-1,3-diazatricyclo[6.4.1.04,13]trideca-4,6,8(13)-trien-2-one |
| SMILES | C[C@H](CCn1cnc2ccccc21)N[C@@H]1CCn2c(=O)[nH]c3cccc(c32)[C@H]1O |
| InChI | InChI=1S/C22H25N5O2/c1-14(9-11-26-13-23-16-6-2-3-8-19(16)26)24-18-10-12-27-20-15(21(18)28)5-4-7-17(20)25-22(27)29/h2-8,13-14,18,21,24,28H,9-12H2,1H3,(H,25,29)/t14-,18-,21-/m1/s1 |
| InChIKey | RYUJLPKWXBFWCX-CFCCAZDESA-N |
| XLogP | 2.55 |
| TPSA | 87.87 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.48 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |