C20H30ClNO4 — CID 69245074
5-(2,6-dimethylmorpholin-4-yl)-1-(4-ethoxy-3-methoxyphenyl)pent-1-en-3-one;hydrochloride (PubChem CID 69245074) has the molecular formula C20H30ClNO4 and a molecular weight of 383.92 g/mol. Its IUPAC name is 5-(2,6-dimethylmorpholin-4-yl)-1-(4-ethoxy-3-methoxyphenyl)pent-1-en-3-one;hydrochloride.
| Compound Name | 5-(2,6-dimethylmorpholin-4-yl)-1-(4-ethoxy-3-methoxyphenyl)pent-1-en-3-one;hydrochloride |
|---|---|
| PubChem CID | 69245074 |
| Molecular Formula | C20H30ClNO4 |
| Molecular Weight | 383.92 g/mol |
| Exact Mass | 383.19 |
| IUPAC Name | 5-(2,6-dimethylmorpholin-4-yl)-1-(4-ethoxy-3-methoxyphenyl)pent-1-en-3-one;hydrochloride |
| SMILES | CCOc1ccc(C=CC(=O)CCN2CC(C)OC(C)C2)cc1OC.Cl |
| InChI | InChI=1S/C20H29NO4.ClH/c1-5-24-19-9-7-17(12-20(19)23-4)6-8-18(22)10-11-21-13-15(2)25-16(3)14-21;/h6-9,12,15-16H,5,10-11,13-14H2,1-4H3;1H |
| InChIKey | RYPUUZZCPOCYJA-UHFFFAOYSA-N |
| XLogP | 3.60 |
| TPSA | 48.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.92 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|