C23H27F3N2O4 — CID 69248143
4-[2-[2-[5-hydroxy-2-methyl-6-[3-(trifluoromethyl)phenyl]hexanoyl]hydrazinyl]ethyl]benzoic acid (PubChem CID 69248143) has the molecular formula C23H27F3N2O4 and a molecular weight of 452.47 g/mol. Its IUPAC name is 4-[2-[2-[5-hydroxy-2-methyl-6-[3-(trifluoromethyl)phenyl]hexanoyl]hydrazinyl]ethyl]benzoic acid.
| Compound Name | 4-[2-[2-[5-hydroxy-2-methyl-6-[3-(trifluoromethyl)phenyl]hexanoyl]hydrazinyl]ethyl]benzoic acid |
|---|---|
| PubChem CID | 69248143 |
| Molecular Formula | C23H27F3N2O4 |
| Molecular Weight | 452.47 g/mol |
| Exact Mass | 452.19 |
| IUPAC Name | 4-[2-[2-[5-hydroxy-2-methyl-6-[3-(trifluoromethyl)phenyl]hexanoyl]hydrazinyl]ethyl]benzoic acid |
| SMILES | CC(CCC(O)Cc1cccc(C(F)(F)F)c1)C(=O)NNCCc1ccc(C(=O)O)cc1 |
| InChI | InChI=1S/C23H27F3N2O4/c1-15(5-10-20(29)14-17-3-2-4-19(13-17)23(24,25)26)21(30)28-27-12-11-16-6-8-18(9-7-16)22(31)32/h2-4,6-9,13,15,20,27,29H,5,10-12,14H2,1H3,(H,28,30)(H,31,32) |
| InChIKey | NUSNJSRJRWTWSP-UHFFFAOYSA-N |
| XLogP | 3.59 |
| TPSA | 98.66 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.47 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|