C18H17N3O5S — CID 69257007
[4-benzyl-3-(4-methylsulfonylphenyl)-1H-pyrazol-5-yl]methyl nitrate (PubChem CID 69257007) has the molecular formula C18H17N3O5S and a molecular weight of 387.42 g/mol. Its IUPAC name is [4-benzyl-3-(4-methylsulfonylphenyl)-1H-pyrazol-5-yl]methyl nitrate.
| Compound Name | [4-benzyl-3-(4-methylsulfonylphenyl)-1H-pyrazol-5-yl]methyl nitrate |
|---|---|
| PubChem CID | 69257007 |
| Molecular Formula | C18H17N3O5S |
| Molecular Weight | 387.42 g/mol |
| Exact Mass | 387.09 |
| IUPAC Name | [4-benzyl-3-(4-methylsulfonylphenyl)-1H-pyrazol-5-yl]methyl nitrate |
| SMILES | CS(=O)(=O)c1ccc(-c2n[nH]c(CO[N+](=O)[O-])c2Cc2ccccc2)cc1 |
| InChI | InChI=1S/C18H17N3O5S/c1-27(24,25)15-9-7-14(8-10-15)18-16(11-13-5-3-2-4-6-13)17(19-20-18)12-26-21(22)23/h2-10H,11-12H2,1H3,(H,19,20) |
| InChIKey | JOAZSBBQWNKDFZ-UHFFFAOYSA-N |
| XLogP | 2.78 |
| TPSA | 115.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.42 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|