C19H18N2O4S — CID 69257130
methyl 4-benzyl-3-(4-methylsulfonylphenyl)-1H-pyrazole-5-carboxylate (PubChem CID 69257130) has the molecular formula C19H18N2O4S and a molecular weight of 370.43 g/mol. Its IUPAC name is methyl 4-benzyl-3-(4-methylsulfonylphenyl)-1H-pyrazole-5-carboxylate.
| Compound Name | methyl 4-benzyl-3-(4-methylsulfonylphenyl)-1H-pyrazole-5-carboxylate |
|---|---|
| PubChem CID | 69257130 |
| Molecular Formula | C19H18N2O4S |
| Molecular Weight | 370.43 g/mol |
| Exact Mass | 370.10 |
| IUPAC Name | methyl 4-benzyl-3-(4-methylsulfonylphenyl)-1H-pyrazole-5-carboxylate |
| SMILES | COC(=O)c1[nH]nc(-c2ccc(S(C)(=O)=O)cc2)c1Cc1ccccc1 |
| InChI | InChI=1S/C19H18N2O4S/c1-25-19(22)18-16(12-13-6-4-3-5-7-13)17(20-21-18)14-8-10-15(11-9-14)26(2,23)24/h3-11H,12H2,1-2H3,(H,20,21) |
| InChIKey | IGOWPPVZNCLYEB-UHFFFAOYSA-N |
| XLogP | 2.86 |
| TPSA | 89.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.43 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |