C12H8N3O3S- — CID 6925830
2-[2-(1,3-benzothiazol-2-yl)-3-oxo-1H-pyrazol-5-yl]acetate (PubChem CID 6925830) has the molecular formula C12H8N3O3S- and a molecular weight of 274.28 g/mol. Its IUPAC name is 2-[2-(1,3-benzothiazol-2-yl)-3-oxo-1H-pyrazol-5-yl]acetate.
| Compound Name | 2-[2-(1,3-benzothiazol-2-yl)-3-oxo-1H-pyrazol-5-yl]acetate |
|---|---|
| PubChem CID | 6925830 |
| Molecular Formula | C12H8N3O3S- |
| Molecular Weight | 274.28 g/mol |
| Exact Mass | 274.03 |
| IUPAC Name | 2-[2-(1,3-benzothiazol-2-yl)-3-oxo-1H-pyrazol-5-yl]acetate |
| SMILES | O=C([O-])Cc1cc(=O)n(-c2nc3ccccc3s2)[nH]1 |
| InChI | InChI=1S/C12H9N3O3S/c16-10-5-7(6-11(17)18)14-15(10)12-13-8-3-1-2-4-9(8)19-12/h1-5,14H,6H2,(H,17,18)/p-1 |
| InChIKey | VWCCPDYRGOYSRL-UHFFFAOYSA-M |
| XLogP | 0.07 |
| TPSA | 90.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.28 |
| LogP ≤ 5 | 0.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |