C19H23N5O4S — CID 69265080
(2R,3R,5S)-5-(hydroxymethyl)-2-[6-[(4-methoxyphenyl)methylsulfanylmethylamino]purin-9-yl]oxolan-3-ol (PubChem CID 69265080) has the molecular formula C19H23N5O4S and a molecular weight of 417.49 g/mol. Its IUPAC name is (2R,3R,5S)-5-(hydroxymethyl)-2-[6-[(4-methoxyphenyl)methylsulfanylmethylamino]purin-9-yl]oxolan-3-ol.
| Compound Name | (2R,3R,5S)-5-(hydroxymethyl)-2-[6-[(4-methoxyphenyl)methylsulfanylmethylamino]purin-9-yl]oxolan-3-ol |
|---|---|
| PubChem CID | 69265080 |
| Molecular Formula | C19H23N5O4S |
| Molecular Weight | 417.49 g/mol |
| Exact Mass | 417.15 |
| IUPAC Name | (2R,3R,5S)-5-(hydroxymethyl)-2-[6-[(4-methoxyphenyl)methylsulfanylmethylamino]purin-9-yl]oxolan-3-ol |
| SMILES | COc1ccc(CSCNc2ncnc3c2ncn3[C@@H]2O[C@H](CO)C[C@H]2O)cc1 |
| InChI | InChI=1S/C19H23N5O4S/c1-27-13-4-2-12(3-5-13)8-29-11-23-17-16-18(21-9-20-17)24(10-22-16)19-15(26)6-14(7-25)28-19/h2-5,9-10,14-15,19,25-26H,6-8,11H2,1H3,(H,20,21,23)/t14-,15+,19+/m0/s1 |
| InChIKey | RBXTWPREAOQFDJ-QMTMVMCOSA-N |
| XLogP | 1.78 |
| TPSA | 114.55 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.49 |
| LogP ≤ 5 | 1.78 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|