C22H18ClNO6 — CID 69267968
methyl (2Z)-2-[(2-chlorophenyl)methylidene]-4-[2-(1,3-dioxoisoindol-2-yl)ethoxy]-3-oxobutanoate (PubChem CID 69267968) has the molecular formula C22H18ClNO6 and a molecular weight of 427.84 g/mol. Its IUPAC name is methyl (2Z)-2-[(2-chlorophenyl)methylidene]-4-[2-(1,3-dioxoisoindol-2-yl)ethoxy]-3-oxobutanoate.
| Compound Name | methyl (2Z)-2-[(2-chlorophenyl)methylidene]-4-[2-(1,3-dioxoisoindol-2-yl)ethoxy]-3-oxobutanoate |
|---|---|
| PubChem CID | 69267968 |
| Molecular Formula | C22H18ClNO6 |
| Molecular Weight | 427.84 g/mol |
| Exact Mass | 427.08 |
| IUPAC Name | methyl (2Z)-2-[(2-chlorophenyl)methylidene]-4-[2-(1,3-dioxoisoindol-2-yl)ethoxy]-3-oxobutanoate |
| SMILES | COC(=O)/C(=C\c1ccccc1Cl)C(=O)COCCN1C(=O)c2ccccc2C1=O |
| InChI | InChI=1S/C22H18ClNO6/c1-29-22(28)17(12-14-6-2-5-9-18(14)23)19(25)13-30-11-10-24-20(26)15-7-3-4-8-16(15)21(24)27/h2-9,12H,10-11,13H2,1H3/b17-12- |
| InChIKey | LIEUUVNTNFGYDX-ATVHPVEESA-N |
| XLogP | 2.78 |
| TPSA | 89.98 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.84 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|