C15H14ClNO2S2 — CID 6927365
2-[(2R)-butan-2-yl]sulfonyl-4-(4-chlorophenyl)thiophene-3-carbonitrile (PubChem CID 6927365) has the molecular formula C15H14ClNO2S2 and a molecular weight of 339.87 g/mol. Its IUPAC name is 2-[(2R)-butan-2-yl]sulfonyl-4-(4-chlorophenyl)thiophene-3-carbonitrile.
| Compound Name | 2-[(2R)-butan-2-yl]sulfonyl-4-(4-chlorophenyl)thiophene-3-carbonitrile |
|---|---|
| PubChem CID | 6927365 |
| Molecular Formula | C15H14ClNO2S2 |
| Molecular Weight | 339.87 g/mol |
| Exact Mass | 339.02 |
| IUPAC Name | 2-[(2R)-butan-2-yl]sulfonyl-4-(4-chlorophenyl)thiophene-3-carbonitrile |
| SMILES | CC[C@@H](C)S(=O)(=O)c1scc(-c2ccc(Cl)cc2)c1C#N |
| InChI | InChI=1S/C15H14ClNO2S2/c1-3-10(2)21(18,19)15-13(8-17)14(9-20-15)11-4-6-12(16)7-5-11/h4-7,9-10H,3H2,1-2H3/t10-/m1/s1 |
| InChIKey | ZNEORAWGNSFKQW-SNVBAGLBSA-N |
| XLogP | 4.51 |
| TPSA | 57.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.87 |
| LogP ≤ 5 | 4.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |