C18H24N2O6 — CID 69284399
[7-(3-hydroxypropoxy)-6-methoxy-4-oxoquinazolin-3-yl] 2,2-dimethylbutanoate (PubChem CID 69284399) has the molecular formula C18H24N2O6 and a molecular weight of 364.40 g/mol. Its IUPAC name is [7-(3-hydroxypropoxy)-6-methoxy-4-oxoquinazolin-3-yl] 2,2-dimethylbutanoate.
| Compound Name | [7-(3-hydroxypropoxy)-6-methoxy-4-oxoquinazolin-3-yl] 2,2-dimethylbutanoate |
|---|---|
| PubChem CID | 69284399 |
| Molecular Formula | C18H24N2O6 |
| Molecular Weight | 364.40 g/mol |
| Exact Mass | 364.16 |
| IUPAC Name | [7-(3-hydroxypropoxy)-6-methoxy-4-oxoquinazolin-3-yl] 2,2-dimethylbutanoate |
| SMILES | CCC(C)(C)C(=O)On1cnc2cc(OCCCO)c(OC)cc2c1=O |
| InChI | InChI=1S/C18H24N2O6/c1-5-18(2,3)17(23)26-20-11-19-13-10-15(25-8-6-7-21)14(24-4)9-12(13)16(20)22/h9-11,21H,5-8H2,1-4H3 |
| InChIKey | NWMPULKDKNDVCB-UHFFFAOYSA-N |
| XLogP | 1.56 |
| TPSA | 99.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.40 |
| LogP ≤ 5 | 1.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|