C14H18N2O3 — CID 7749368
3-tert-butyl-6,7-dimethoxyquinazolin-4-one (PubChem CID 7749368) has the molecular formula C14H18N2O3 and a molecular weight of 262.31 g/mol. Its IUPAC name is 3-tert-butyl-6,7-dimethoxyquinazolin-4-one.
| Compound Name | 3-tert-butyl-6,7-dimethoxyquinazolin-4-one |
|---|---|
| PubChem CID | 7749368 |
| Molecular Formula | C14H18N2O3 |
| Molecular Weight | 262.31 g/mol |
| Exact Mass | 262.13 |
| IUPAC Name | 3-tert-butyl-6,7-dimethoxyquinazolin-4-one |
| SMILES | COc1cc2ncn(C(C)(C)C)c(=O)c2cc1OC |
| InChI | InChI=1S/C14H18N2O3/c1-14(2,3)16-8-15-10-7-12(19-5)11(18-4)6-9(10)13(16)17/h6-8H,1-5H3 |
| InChIKey | ZYCLHNLGCMVDFC-UHFFFAOYSA-N |
| XLogP | 2.17 |
| TPSA | 53.35 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.31 |
| LogP ≤ 5 | 2.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |