C16H14ClN2OS+ — CID 692849
N-(2-chlorophenyl)-4-(4-methoxyphenyl)-1,3-thiazol-3-ium-2-amine (PubChem CID 692849) has the molecular formula C16H14ClN2OS+ and a molecular weight of 317.82 g/mol. Its IUPAC name is N-(2-chlorophenyl)-4-(4-methoxyphenyl)-1,3-thiazol-3-ium-2-amine.
| Compound Name | N-(2-chlorophenyl)-4-(4-methoxyphenyl)-1,3-thiazol-3-ium-2-amine |
|---|---|
| PubChem CID | 692849 |
| Molecular Formula | C16H14ClN2OS+ |
| Molecular Weight | 317.82 g/mol |
| Exact Mass | 317.05 |
| IUPAC Name | N-(2-chlorophenyl)-4-(4-methoxyphenyl)-1,3-thiazol-3-ium-2-amine |
| SMILES | COc1ccc(-c2csc(Nc3ccccc3Cl)[nH+]2)cc1 |
| InChI | InChI=1S/C16H13ClN2OS/c1-20-12-8-6-11(7-9-12)15-10-21-16(19-15)18-14-5-3-2-4-13(14)17/h2-10H,1H3,(H,18,19)/p+1 |
| InChIKey | QHDGUWSPSFTZHV-UHFFFAOYSA-O |
| XLogP | 4.63 |
| TPSA | 35.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.82 |
| LogP ≤ 5 | 4.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'thiaz_ene_D(8)', 'substructure': 'N/A'} |
|---|