C21H40O2 — CID 69287627
5-dodecan-2-yl-2,2-dimethyl-5-prop-2-enyl-1,3-dioxane (PubChem CID 69287627) has the molecular formula C21H40O2 and a molecular weight of 324.55 g/mol. Its IUPAC name is 5-dodecan-2-yl-2,2-dimethyl-5-prop-2-enyl-1,3-dioxane.
| Compound Name | 5-dodecan-2-yl-2,2-dimethyl-5-prop-2-enyl-1,3-dioxane |
|---|---|
| PubChem CID | 69287627 |
| Molecular Formula | C21H40O2 |
| Molecular Weight | 324.55 g/mol |
| Exact Mass | 324.30 |
| IUPAC Name | 5-dodecan-2-yl-2,2-dimethyl-5-prop-2-enyl-1,3-dioxane |
| SMILES | C=CCC1(C(C)CCCCCCCCCC)COC(C)(C)OC1 |
| InChI | InChI=1S/C21H40O2/c1-6-8-9-10-11-12-13-14-15-19(3)21(16-7-2)17-22-20(4,5)23-18-21/h7,19H,2,6,8-18H2,1,3-5H3 |
| InChIKey | HLQUCIPBSREZRN-UHFFFAOYSA-N |
| XLogP | 6.50 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.55 |
| LogP ≤ 5 | 6.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|